C25H30N6O4 — CID 59964909
(2S)-2,6-diamino-N-[(2R)-3-hydroxy-1-oxo-1-[(12-oxo-10H-isoindolo[1,2-b]quinazolin-8-yl)amino]butan-2-yl]hexanamide (PubChem CID 59964909) has the molecular formula C25H30N6O4 and a molecular weight of 478.55 g/mol. Its IUPAC name is (2S)-2,6-diamino-N-[(2R)-3-hydroxy-1-oxo-1-[(12-oxo-10H-isoindolo[1,2-b]quinazolin-8-yl)amino]butan-2-yl]hexanamide.
| Compound Name | (2S)-2,6-diamino-N-[(2R)-3-hydroxy-1-oxo-1-[(12-oxo-10H-isoindolo[1,2-b]quinazolin-8-yl)amino]butan-2-yl]hexanamide |
|---|---|
| PubChem CID | 59964909 |
| Molecular Formula | C25H30N6O4 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | (2S)-2,6-diamino-N-[(2R)-3-hydroxy-1-oxo-1-[(12-oxo-10H-isoindolo[1,2-b]quinazolin-8-yl)amino]butan-2-yl]hexanamide |
| SMILES | CC(O)[C@@H](NC(=O)[C@@H](N)CCCCN)C(=O)Nc1ccc2c(c1)CN1C(=O)c3ccccc3C1=N2 |
| InChI | InChI=1S/C25H30N6O4/c1-14(32)21(30-23(33)19(27)8-4-5-11-26)24(34)28-16-9-10-20-15(12-16)13-31-22(29-20)17-6-2-3-7-18(17)25(31)35/h2-3,6-7,9-10,12,14,19,21,32H,4-5,8,11,13,26-27H2,1H3,(H,28,34)(H,30,33)/t14?,19-,21+/m0/s1 |
| InChIKey | UGGOZCNOLCCSON-BVLLHJTKSA-N |
| XLogP | 0.99 |
| TPSA | 163.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|