C16H30Y-2 — CID 59970207
carbanide;1,2,4,5,6,7-hexamethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-3-ide;yttrium (PubChem CID 59970207) has the molecular formula C16H30Y-2 and a molecular weight of 311.32 g/mol. Its IUPAC name is carbanide;1,2,4,5,6,7-hexamethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-3-ide;yttrium.
| Compound Name | carbanide;1,2,4,5,6,7-hexamethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-3-ide;yttrium |
|---|---|
| PubChem CID | 59970207 |
| Molecular Formula | C16H30Y-2 |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | carbanide;1,2,4,5,6,7-hexamethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-3-ide;yttrium |
| SMILES | CC1[CH-]C2C(C)C(C)C(C)C(C)C2C1C.[CH3-].[Y] |
| InChI | InChI=1S/C15H27.CH3.Y/c1-8-7-14-12(5)10(3)11(4)13(6)15(14)9(8)2;;/h7-15H,1-6H3;1H3;/q2*-1; |
| InChIKey | FVOSTIQZFWHXKS-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|