C26H46Y-2 — CID 59966240
bis(1,2,4,7-tetramethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-3-ide);yttrium (PubChem CID 59966240) has the molecular formula C26H46Y-2 and a molecular weight of 447.56 g/mol. Its IUPAC name is bis(1,2,4,7-tetramethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-3-ide);yttrium.
| Compound Name | bis(1,2,4,7-tetramethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-3-ide);yttrium |
|---|---|
| PubChem CID | 59966240 |
| Molecular Formula | C26H46Y-2 |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.27 |
| IUPAC Name | bis(1,2,4,7-tetramethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-3-ide);yttrium |
| SMILES | CC1[CH-]C2C(C)CCC(C)C2C1C.CC1[CH-]C2C(C)CCC(C)C2C1C.[Y] |
| InChI | InChI=1S/2C13H23.Y/c2*1-8-5-6-9(2)13-11(4)10(3)7-12(8)13;/h2*7-13H,5-6H2,1-4H3;/q2*-1; |
| InChIKey | UUKAXTGLMHQKHG-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|