C26H27ClFNO2 — CID 59975474
(1R,3aR,4aS,5R,8aR,9S,9aS)-9-[(E)-2-[5-(2-chlorophenyl)-2-pyridinyl]ethenyl]-5-fluoro-1-methyl-3a,4,4a,5,6,7,8,8a,9,9a-decahydro-1H-benzo[f][2]benzofuran-3-one (PubChem CID 59975474) has the molecular formula C26H27ClFNO2 and a molecular weight of 439.96 g/mol. Its IUPAC name is (1R,3aR,4aS,5R,8aR,9S,9aS)-9-[(E)-2-[5-(2-chlorophenyl)-2-pyridinyl]ethenyl]-5-fluoro-1-methyl-3a,4,4a,5,6,7,8,8a,9,9a-decahydro-1H-benzo[f][2]benzofuran-3-one.
| Compound Name | (1R,3aR,4aS,5R,8aR,9S,9aS)-9-[(E)-2-[5-(2-chlorophenyl)-2-pyridinyl]ethenyl]-5-fluoro-1-methyl-3a,4,4a,5,6,7,8,8a,9,9a-decahydro-1H-benzo[f][2]benzofuran-3-one |
|---|---|
| PubChem CID | 59975474 |
| Molecular Formula | C26H27ClFNO2 |
| Molecular Weight | 439.96 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | (1R,3aR,4aS,5R,8aR,9S,9aS)-9-[(E)-2-[5-(2-chlorophenyl)-2-pyridinyl]ethenyl]-5-fluoro-1-methyl-3a,4,4a,5,6,7,8,8a,9,9a-decahydro-1H-benzo[f][2]benzofuran-3-one |
| SMILES | C[C@H]1OC(=O)[C@@H]2C[C@H]3[C@H](CCC[C@H]3F)[C@H](/C=C/c3ccc(-c4ccccc4Cl)cn3)[C@H]12 |
| InChI | InChI=1S/C26H27ClFNO2/c1-15-25-20(19-6-4-8-24(28)21(19)13-22(25)26(30)31-15)12-11-17-10-9-16(14-29-17)18-5-2-3-7-23(18)27/h2-3,5,7,9-12,14-15,19-22,24-25H,4,6,8,13H2,1H3/b12-11+/t15-,19-,20+,21+,22-,24-,25+/m1/s1 |
| InChIKey | VTZHBNHJNUNIPK-YHMWYNHBSA-N |
| XLogP | 6.37 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.96 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |