C10H16OS — CID 59977187
2-[(2Z,4E)-6-methylhepta-2,4-dienyl]sulfanylacetaldehyde (PubChem CID 59977187) has the molecular formula C10H16OS and a molecular weight of 184.30 g/mol. Its IUPAC name is 2-[(2Z,4E)-6-methylhepta-2,4-dienyl]sulfanylacetaldehyde.
| Compound Name | 2-[(2Z,4E)-6-methylhepta-2,4-dienyl]sulfanylacetaldehyde |
|---|---|
| PubChem CID | 59977187 |
| Molecular Formula | C10H16OS |
| Molecular Weight | 184.30 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | 2-[(2Z,4E)-6-methylhepta-2,4-dienyl]sulfanylacetaldehyde |
| SMILES | CC(C)/C=C/C=C\CSCC=O |
| InChI | InChI=1S/C10H16OS/c1-10(2)6-4-3-5-8-12-9-7-11/h3-7,10H,8-9H2,1-2H3/b5-3-,6-4+ |
| InChIKey | LJCMVQLEZMVFPT-CIIODKQPSA-N |
| XLogP | 2.69 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.30 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|