C31H56O8Si — CID 59990650
methyl (Z,3S,6R,7S,8S)-15-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-4,4,6,8,12-pentamethyl-5,16-dioxoheptadec-12-enoate (PubChem CID 59990650) has the molecular formula C31H56O8Si and a molecular weight of 584.87 g/mol. Its IUPAC name is methyl (Z,3S,6R,7S,8S)-15-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-4,4,6,8,12-pentamethyl-5,16-dioxoheptadec-12-enoate.
| Compound Name | methyl (Z,3S,6R,7S,8S)-15-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-4,4,6,8,12-pentamethyl-5,16-dioxoheptadec-12-enoate |
|---|---|
| PubChem CID | 59990650 |
| Molecular Formula | C31H56O8Si |
| Molecular Weight | 584.87 g/mol |
| Exact Mass | 584.37 |
| IUPAC Name | methyl (Z,3S,6R,7S,8S)-15-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-4,4,6,8,12-pentamethyl-5,16-dioxoheptadec-12-enoate |
| SMILES | COC(=O)C[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)C(=O)[C@H](C)[C@@H](O)[C@@H](C)CCC/C(C)=C\CC(OC(C)=O)C(C)=O |
| InChI | InChI=1S/C31H56O8Si/c1-20(17-18-25(23(4)32)38-24(5)33)15-14-16-21(2)28(35)22(3)29(36)31(9,10)26(19-27(34)37-11)39-40(12,13)30(6,7)8/h17,21-22,25-26,28,35H,14-16,18-19H2,1-13H3/b20-17-/t21-,22+,25?,26-,28-/m0/s1 |
| InChIKey | AKAPATXXSNVQBD-OBYPNQROSA-N |
| XLogP | 6.20 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.87 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|