C15H12BrF2N3S — CID 6055009
1-[(Z)-1-(2-bromophenyl)ethylideneamino]-3-(2,4-difluorophenyl)thiourea (PubChem CID 6055009) has the molecular formula C15H12BrF2N3S and a molecular weight of 384.25 g/mol. Its IUPAC name is 1-[(Z)-1-(2-bromophenyl)ethylideneamino]-3-(2,4-difluorophenyl)thiourea.
| Compound Name | 1-[(Z)-1-(2-bromophenyl)ethylideneamino]-3-(2,4-difluorophenyl)thiourea |
|---|---|
| PubChem CID | 6055009 |
| Molecular Formula | C15H12BrF2N3S |
| Molecular Weight | 384.25 g/mol |
| Exact Mass | 382.99 |
| IUPAC Name | 1-[(Z)-1-(2-bromophenyl)ethylideneamino]-3-(2,4-difluorophenyl)thiourea |
| SMILES | C/C(=N/NC(=S)Nc1ccc(F)cc1F)c1ccccc1Br |
| InChI | InChI=1S/C15H12BrF2N3S/c1-9(11-4-2-3-5-12(11)16)20-21-15(22)19-14-7-6-10(17)8-13(14)18/h2-8H,1H3,(H2,19,21,22)/b20-9- |
| InChIKey | XHIKRVVSHJOBJZ-UKWGHVSLSA-N |
| XLogP | 4.44 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.25 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|