C20H15BrF2N4O2S — CID 28693402
5-bromo-N-[3-[(Z)-N-[(2,4-difluorophenyl)carbamothioylamino]-C-methylcarbonimidoyl]phenyl]furan-2-carboxamide (PubChem CID 28693402) has the molecular formula C20H15BrF2N4O2S and a molecular weight of 493.33 g/mol. Its IUPAC name is 5-bromo-N-[3-[(Z)-N-[(2,4-difluorophenyl)carbamothioylamino]-C-methylcarbonimidoyl]phenyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[3-[(Z)-N-[(2,4-difluorophenyl)carbamothioylamino]-C-methylcarbonimidoyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 28693402 |
| Molecular Formula | C20H15BrF2N4O2S |
| Molecular Weight | 493.33 g/mol |
| Exact Mass | 492.01 |
| IUPAC Name | 5-bromo-N-[3-[(Z)-N-[(2,4-difluorophenyl)carbamothioylamino]-C-methylcarbonimidoyl]phenyl]furan-2-carboxamide |
| SMILES | C/C(=N/NC(=S)Nc1ccc(F)cc1F)c1cccc(NC(=O)c2ccc(Br)o2)c1 |
| InChI | InChI=1S/C20H15BrF2N4O2S/c1-11(26-27-20(30)25-16-6-5-13(22)10-15(16)23)12-3-2-4-14(9-12)24-19(28)17-7-8-18(21)29-17/h2-10H,1H3,(H,24,28)(H2,25,27,30)/b26-11- |
| InChIKey | AUPYXSHCRVWHIO-RAWMCFOBSA-N |
| XLogP | 5.28 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.33 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|