C21H20BrN3O6S — CID 21167597
5-bromo-N-[3-[(Z)-N-[(2,4-dimethoxyphenyl)sulfonylamino]-C-methylcarbonimidoyl]phenyl]furan-2-carboxamide (PubChem CID 21167597) has the molecular formula C21H20BrN3O6S and a molecular weight of 522.38 g/mol. Its IUPAC name is 5-bromo-N-[3-[(Z)-N-[(2,4-dimethoxyphenyl)sulfonylamino]-C-methylcarbonimidoyl]phenyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[3-[(Z)-N-[(2,4-dimethoxyphenyl)sulfonylamino]-C-methylcarbonimidoyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 21167597 |
| Molecular Formula | C21H20BrN3O6S |
| Molecular Weight | 522.38 g/mol |
| Exact Mass | 521.03 |
| IUPAC Name | 5-bromo-N-[3-[(Z)-N-[(2,4-dimethoxyphenyl)sulfonylamino]-C-methylcarbonimidoyl]phenyl]furan-2-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N/N=C(/C)c2cccc(NC(=O)c3ccc(Br)o3)c2)c(OC)c1 |
| InChI | InChI=1S/C21H20BrN3O6S/c1-13(24-25-32(27,28)19-9-7-16(29-2)12-18(19)30-3)14-5-4-6-15(11-14)23-21(26)17-8-10-20(22)31-17/h4-12,25H,1-3H3,(H,23,26)/b24-13- |
| InChIKey | SYECBEQMNHRTCP-CFRMEGHHSA-N |
| XLogP | 4.01 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.38 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|