C28H25N3O4 — CID 60570782
N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]-2-(9-oxoacridin-10-yl)acetamide (PubChem CID 60570782) has the molecular formula C28H25N3O4 and a molecular weight of 467.53 g/mol. Its IUPAC name is N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]-2-(9-oxoacridin-10-yl)acetamide.
| Compound Name | N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]-2-(9-oxoacridin-10-yl)acetamide |
|---|---|
| PubChem CID | 60570782 |
| Molecular Formula | C28H25N3O4 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]-2-(9-oxoacridin-10-yl)acetamide |
| SMILES | CCC1(c2ccc(NC(=O)Cn3c4ccccc4c(=O)c4ccccc43)cc2)CCC(=O)NC1=O |
| InChI | InChI=1S/C28H25N3O4/c1-2-28(16-15-24(32)30-27(28)35)18-11-13-19(14-12-18)29-25(33)17-31-22-9-5-3-7-20(22)26(34)21-8-4-6-10-23(21)31/h3-14H,2,15-17H2,1H3,(H,29,33)(H,30,32,35) |
| InChIKey | IHBBJHFBODNRLO-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|