C24H25ClN2O4 — CID 60576020
2-(2-acetyl-1H-isoquinolin-1-yl)-N-[5-chloro-2-(oxolan-2-ylmethoxy)phenyl]acetamide (PubChem CID 60576020) has the molecular formula C24H25ClN2O4 and a molecular weight of 440.93 g/mol. Its IUPAC name is 2-(2-acetyl-1H-isoquinolin-1-yl)-N-[5-chloro-2-(oxolan-2-ylmethoxy)phenyl]acetamide.
| Compound Name | 2-(2-acetyl-1H-isoquinolin-1-yl)-N-[5-chloro-2-(oxolan-2-ylmethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 60576020 |
| Molecular Formula | C24H25ClN2O4 |
| Molecular Weight | 440.93 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 2-(2-acetyl-1H-isoquinolin-1-yl)-N-[5-chloro-2-(oxolan-2-ylmethoxy)phenyl]acetamide |
| SMILES | CC(=O)N1C=Cc2ccccc2C1CC(=O)Nc1cc(Cl)ccc1OCC1CCCO1 |
| InChI | InChI=1S/C24H25ClN2O4/c1-16(28)27-11-10-17-5-2-3-7-20(17)22(27)14-24(29)26-21-13-18(25)8-9-23(21)31-15-19-6-4-12-30-19/h2-3,5,7-11,13,19,22H,4,6,12,14-15H2,1H3,(H,26,29) |
| InChIKey | IUYRBIUWCHKLDM-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.93 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |