C19H24FN3O2S — CID 60582634
4-(3-fluorophenyl)-N-(5-pentyl-1,3,4-thiadiazol-2-yl)oxane-4-carboxamide (PubChem CID 60582634) has the molecular formula C19H24FN3O2S and a molecular weight of 377.49 g/mol. Its IUPAC name is 4-(3-fluorophenyl)-N-(5-pentyl-1,3,4-thiadiazol-2-yl)oxane-4-carboxamide.
| Compound Name | 4-(3-fluorophenyl)-N-(5-pentyl-1,3,4-thiadiazol-2-yl)oxane-4-carboxamide |
|---|---|
| PubChem CID | 60582634 |
| Molecular Formula | C19H24FN3O2S |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 4-(3-fluorophenyl)-N-(5-pentyl-1,3,4-thiadiazol-2-yl)oxane-4-carboxamide |
| SMILES | CCCCCc1nnc(NC(=O)C2(c3cccc(F)c3)CCOCC2)s1 |
| InChI | InChI=1S/C19H24FN3O2S/c1-2-3-4-8-16-22-23-18(26-16)21-17(24)19(9-11-25-12-10-19)14-6-5-7-15(20)13-14/h5-7,13H,2-4,8-12H2,1H3,(H,21,23,24) |
| InChIKey | CJSUTIPNWCPCFU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|