C18H15F4N3O2 — CID 60595910
2-[[2-(3-fluorophenyl)cyclopropyl]carbamoylamino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 60595910) has the molecular formula C18H15F4N3O2 and a molecular weight of 381.33 g/mol. Its IUPAC name is 2-[[2-(3-fluorophenyl)cyclopropyl]carbamoylamino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[[2-(3-fluorophenyl)cyclopropyl]carbamoylamino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 60595910 |
| Molecular Formula | C18H15F4N3O2 |
| Molecular Weight | 381.33 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 2-[[2-(3-fluorophenyl)cyclopropyl]carbamoylamino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | O=C(CNC(=O)NC1CC1c1cccc(F)c1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C18H15F4N3O2/c19-10-3-1-2-9(6-10)11-7-14(11)25-18(27)23-8-15(26)24-13-5-4-12(20)16(21)17(13)22/h1-6,11,14H,7-8H2,(H,24,26)(H2,23,25,27) |
| InChIKey | KZOMEQNRCGUKBC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|