C21H23N3O4S — CID 60612992
2-(2,5-dimethylpyrrol-1-yl)-N-(4-methoxy-3-sulfamoylphenyl)-5-methylbenzamide (PubChem CID 60612992) has the molecular formula C21H23N3O4S and a molecular weight of 413.50 g/mol. Its IUPAC name is 2-(2,5-dimethylpyrrol-1-yl)-N-(4-methoxy-3-sulfamoylphenyl)-5-methylbenzamide.
| Compound Name | 2-(2,5-dimethylpyrrol-1-yl)-N-(4-methoxy-3-sulfamoylphenyl)-5-methylbenzamide |
|---|---|
| PubChem CID | 60612992 |
| Molecular Formula | C21H23N3O4S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 2-(2,5-dimethylpyrrol-1-yl)-N-(4-methoxy-3-sulfamoylphenyl)-5-methylbenzamide |
| SMILES | COc1ccc(NC(=O)c2cc(C)ccc2-n2c(C)ccc2C)cc1S(N)(=O)=O |
| InChI | InChI=1S/C21H23N3O4S/c1-13-5-9-18(24-14(2)6-7-15(24)3)17(11-13)21(25)23-16-8-10-19(28-4)20(12-16)29(22,26)27/h5-12H,1-4H3,(H,23,25)(H2,22,26,27) |
| InChIKey | CYIGSNNVNPWKHQ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 103.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|