C30H21N3OS — CID 6064024
N-[(Z)-[3-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]chromen-2-ylidene]amino]aniline (PubChem CID 6064024) has the molecular formula C30H21N3OS and a molecular weight of 471.59 g/mol. Its IUPAC name is N-[(Z)-[3-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]chromen-2-ylidene]amino]aniline.
| Compound Name | N-[(Z)-[3-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]chromen-2-ylidene]amino]aniline |
|---|---|
| PubChem CID | 6064024 |
| Molecular Formula | C30H21N3OS |
| Molecular Weight | 471.59 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | N-[(Z)-[3-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]chromen-2-ylidene]amino]aniline |
| SMILES | c1ccc(N/N=c2\oc3ccccc3cc2-c2nc(-c3ccc(-c4ccccc4)cc3)cs2)cc1 |
| InChI | InChI=1S/C30H21N3OS/c1-3-9-21(10-4-1)22-15-17-23(18-16-22)27-20-35-30(31-27)26-19-24-11-7-8-14-28(24)34-29(26)33-32-25-12-5-2-6-13-25/h1-20,32H/b33-29- |
| InChIKey | LYVVHTBXPAQVEE-IYOYZZHUSA-N |
| XLogP | 7.82 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.59 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|