C12H14F5NO2 — CID 60732644
N-[[2-(difluoromethoxy)phenyl]methyl]-2-(2,2,2-trifluoroethoxy)ethanamine (PubChem CID 60732644) has the molecular formula C12H14F5NO2 and a molecular weight of 299.24 g/mol. Its IUPAC name is N-[[2-(difluoromethoxy)phenyl]methyl]-2-(2,2,2-trifluoroethoxy)ethanamine.
| Compound Name | N-[[2-(difluoromethoxy)phenyl]methyl]-2-(2,2,2-trifluoroethoxy)ethanamine |
|---|---|
| PubChem CID | 60732644 |
| Molecular Formula | C12H14F5NO2 |
| Molecular Weight | 299.24 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | N-[[2-(difluoromethoxy)phenyl]methyl]-2-(2,2,2-trifluoroethoxy)ethanamine |
| SMILES | FC(F)Oc1ccccc1CNCCOCC(F)(F)F |
| InChI | InChI=1S/C12H14F5NO2/c13-11(14)20-10-4-2-1-3-9(10)7-18-5-6-19-8-12(15,16)17/h1-4,11,18H,5-8H2 |
| InChIKey | GRVMSNHJDZUKPO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.24 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|