C17H22O5S — CID 607934
spiro[1,3-dioxolane-2,6'-bicyclo[2.2.1]heptane]-2'-ylmethyl 4-methylbenzenesulfonate (PubChem CID 607934) has the molecular formula C17H22O5S and a molecular weight of 338.43 g/mol. Its IUPAC name is spiro[1,3-dioxolane-2,6'-bicyclo[2.2.1]heptane]-2'-ylmethyl 4-methylbenzenesulfonate.
| Compound Name | spiro[1,3-dioxolane-2,6'-bicyclo[2.2.1]heptane]-2'-ylmethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 607934 |
| Molecular Formula | C17H22O5S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | spiro[1,3-dioxolane-2,6'-bicyclo[2.2.1]heptane]-2'-ylmethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2CC3CC2C2(C3)OCCO2)cc1 |
| InChI | InChI=1S/C17H22O5S/c1-12-2-4-15(5-3-12)23(18,19)22-11-14-8-13-9-16(14)17(10-13)20-6-7-21-17/h2-5,13-14,16H,6-11H2,1H3 |
| InChIKey | XYQUKCCLEMGTNK-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|