C20H28O5S — CID 57251194
[(1R,2S,3S,4S)-3-(oxan-2-yloxy)-2-bicyclo[2.2.1]heptanyl]methyl 4-methylbenzenesulfonate (PubChem CID 57251194) has the molecular formula C20H28O5S and a molecular weight of 380.51 g/mol. Its IUPAC name is [(1R,2S,3S,4S)-3-(oxan-2-yloxy)-2-bicyclo[2.2.1]heptanyl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(1R,2S,3S,4S)-3-(oxan-2-yloxy)-2-bicyclo[2.2.1]heptanyl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 57251194 |
| Molecular Formula | C20H28O5S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | [(1R,2S,3S,4S)-3-(oxan-2-yloxy)-2-bicyclo[2.2.1]heptanyl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H]2[C@@H]3CC[C@@H](C3)[C@@H]2OC2CCCCO2)cc1 |
| InChI | InChI=1S/C20H28O5S/c1-14-5-9-17(10-6-14)26(21,22)24-13-18-15-7-8-16(12-15)20(18)25-19-4-2-3-11-23-19/h5-6,9-10,15-16,18-20H,2-4,7-8,11-13H2,1H3/t15-,16+,18-,19?,20+/m1/s1 |
| InChIKey | ARRLMXQDTHZXQU-YLCWFMKGSA-N |
| XLogP | 3.66 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|