C23H36O5S — CID 57024387
[(1R,2S,3R)-3-(oxan-2-yloxy)-2-pentylcyclopentyl]methyl 4-methylbenzenesulfonate (PubChem CID 57024387) has the molecular formula C23H36O5S and a molecular weight of 424.60 g/mol. Its IUPAC name is [(1R,2S,3R)-3-(oxan-2-yloxy)-2-pentylcyclopentyl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(1R,2S,3R)-3-(oxan-2-yloxy)-2-pentylcyclopentyl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 57024387 |
| Molecular Formula | C23H36O5S |
| Molecular Weight | 424.60 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | [(1R,2S,3R)-3-(oxan-2-yloxy)-2-pentylcyclopentyl]methyl 4-methylbenzenesulfonate |
| SMILES | CCCCC[C@H]1[C@H](COS(=O)(=O)c2ccc(C)cc2)CC[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C23H36O5S/c1-3-4-5-8-21-19(12-15-22(21)28-23-9-6-7-16-26-23)17-27-29(24,25)20-13-10-18(2)11-14-20/h10-11,13-14,19,21-23H,3-9,12,15-17H2,1-2H3/t19-,21-,22+,23?/m0/s1 |
| InChIKey | BGGONEHJSDLNOB-ATNRPFFGSA-N |
| XLogP | 5.22 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.60 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|