C20H26O6S — CID 101012298
[(4S,9S)-6-butyl-4-hydroxy-5,7-dioxatetracyclo[6.3.0.02,6.03,10]undecan-9-yl] 4-methylbenzenesulfonate (PubChem CID 101012298) has the molecular formula C20H26O6S and a molecular weight of 394.49 g/mol. Its IUPAC name is [(4S,9S)-6-butyl-4-hydroxy-5,7-dioxatetracyclo[6.3.0.02,6.03,10]undecan-9-yl] 4-methylbenzenesulfonate.
| Compound Name | [(4S,9S)-6-butyl-4-hydroxy-5,7-dioxatetracyclo[6.3.0.02,6.03,10]undecan-9-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 101012298 |
| Molecular Formula | C20H26O6S |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | [(4S,9S)-6-butyl-4-hydroxy-5,7-dioxatetracyclo[6.3.0.02,6.03,10]undecan-9-yl] 4-methylbenzenesulfonate |
| SMILES | CCCCC12OC(O)C3C4CC(C(O1)[C@H]4OS(=O)(=O)c1ccc(C)cc1)C32 |
| InChI | InChI=1S/C20H26O6S/c1-3-4-9-20-16-14-10-13(15(16)19(21)25-20)18(17(14)24-20)26-27(22,23)12-7-5-11(2)6-8-12/h5-8,13-19,21H,3-4,9-10H2,1-2H3/t13?,14?,15?,16?,17?,18-,19?,20?/m0/s1 |
| InChIKey | BSLGNLQOAOHLKO-CXDQNNGZSA-N |
| XLogP | 2.58 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|