C28H34O7S — CID 139828831
[5-[(2-methylpropan-2-yl)oxycarbonyloxy]-15-oxahexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-11-en-4-yl] 4-methylbenzenesulfonate (PubChem CID 139828831) has the molecular formula C28H34O7S and a molecular weight of 514.64 g/mol. Its IUPAC name is [5-[(2-methylpropan-2-yl)oxycarbonyloxy]-15-oxahexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-11-en-4-yl] 4-methylbenzenesulfonate.
| Compound Name | [5-[(2-methylpropan-2-yl)oxycarbonyloxy]-15-oxahexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-11-en-4-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 139828831 |
| Molecular Formula | C28H34O7S |
| Molecular Weight | 514.64 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | [5-[(2-methylpropan-2-yl)oxycarbonyloxy]-15-oxahexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-11-en-4-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2C3CC(C2OC(=O)OC(C)(C)C)C2C4OC(C5C6C=CC(C6)C45)C32)cc1 |
| InChI | InChI=1S/C28H34O7S/c1-13-5-9-16(10-6-13)36(30,31)35-24-18-12-17(23(24)33-27(29)34-28(2,3)4)21-22(18)26-20-15-8-7-14(11-15)19(20)25(21)32-26/h5-10,14-15,17-26H,11-12H2,1-4H3 |
| InChIKey | BZCCAWPNDMEKEQ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.64 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|