C25H30O7S — CID 139797003
[5-(oxan-2-yloxycarbonyloxy)-4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl] 4-methylbenzenesulfonate (PubChem CID 139797003) has the molecular formula C25H30O7S and a molecular weight of 474.58 g/mol. Its IUPAC name is [5-(oxan-2-yloxycarbonyloxy)-4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl] 4-methylbenzenesulfonate.
| Compound Name | [5-(oxan-2-yloxycarbonyloxy)-4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 139797003 |
| Molecular Formula | C25H30O7S |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | [5-(oxan-2-yloxycarbonyloxy)-4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2C3CC(C2OC(=O)OC2CCCCO2)C2C4C=CC(C4)C32)cc1 |
| InChI | InChI=1S/C25H30O7S/c1-14-5-9-17(10-6-14)33(27,28)32-24-19-13-18(21-15-7-8-16(12-15)22(19)21)23(24)31-25(26)30-20-4-2-3-11-29-20/h5-10,15-16,18-24H,2-4,11-13H2,1H3 |
| InChIKey | CKHMMFRYMISUAK-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|