C15H18O4S — CID 23270924
[(1S,2R,3R,6R,7S)-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 4-methylbenzenesulfonate (PubChem CID 23270924) has the molecular formula C15H18O4S and a molecular weight of 294.37 g/mol. Its IUPAC name is [(1S,2R,3R,6R,7S)-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 4-methylbenzenesulfonate.
| Compound Name | [(1S,2R,3R,6R,7S)-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 23270924 |
| Molecular Formula | C15H18O4S |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | [(1S,2R,3R,6R,7S)-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H]2[C@H]3C[C@H]4CO[C@@H]2[C@H]4C3)cc1 |
| InChI | InChI=1S/C15H18O4S/c1-9-2-4-12(5-3-9)20(16,17)19-14-10-6-11-8-18-15(14)13(11)7-10/h2-5,10-11,13-15H,6-8H2,1H3/t10-,11-,13-,14+,15+/m0/s1 |
| InChIKey | AMXMXNONOMXQKB-XSXPHNMFSA-N |
| XLogP | 2.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|