C17H20O4S — CID 25078509
[(1R,2S,3S,6S,8S,9S,10S)-7-oxatetracyclo[6.3.0.02,6.03,10]undecan-9-yl] 4-methylbenzenesulfonate (PubChem CID 25078509) has the molecular formula C17H20O4S and a molecular weight of 320.41 g/mol. Its IUPAC name is [(1R,2S,3S,6S,8S,9S,10S)-7-oxatetracyclo[6.3.0.02,6.03,10]undecan-9-yl] 4-methylbenzenesulfonate.
| Compound Name | [(1R,2S,3S,6S,8S,9S,10S)-7-oxatetracyclo[6.3.0.02,6.03,10]undecan-9-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 25078509 |
| Molecular Formula | C17H20O4S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | [(1R,2S,3S,6S,8S,9S,10S)-7-oxatetracyclo[6.3.0.02,6.03,10]undecan-9-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H]2[C@H]3C[C@H]4[C@@H]2O[C@H]2CC[C@@H]3[C@@H]42)cc1 |
| InChI | InChI=1S/C17H20O4S/c1-9-2-4-10(5-3-9)22(18,19)21-17-12-8-13-15-11(12)6-7-14(15)20-16(13)17/h2-5,11-17H,6-8H2,1H3/t11-,12-,13+,14-,15-,16-,17-/m0/s1 |
| InChIKey | VTFXRDHSSPGBKM-ZUKRZWFUSA-N |
| XLogP | 2.51 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|