C19H24O6S — CID 10883418
[(1R,2R,3S,4S,6S,8S,9S,10S)-4-hydroxy-4,6-dimethyl-5,7-dioxatetracyclo[6.4.0.02,6.03,10]dodecan-9-yl] 4-methylbenzenesulfonate (PubChem CID 10883418) has the molecular formula C19H24O6S and a molecular weight of 380.46 g/mol. Its IUPAC name is [(1R,2R,3S,4S,6S,8S,9S,10S)-4-hydroxy-4,6-dimethyl-5,7-dioxatetracyclo[6.4.0.02,6.03,10]dodecan-9-yl] 4-methylbenzenesulfonate.
| Compound Name | [(1R,2R,3S,4S,6S,8S,9S,10S)-4-hydroxy-4,6-dimethyl-5,7-dioxatetracyclo[6.4.0.02,6.03,10]dodecan-9-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10883418 |
| Molecular Formula | C19H24O6S |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | [(1R,2R,3S,4S,6S,8S,9S,10S)-4-hydroxy-4,6-dimethyl-5,7-dioxatetracyclo[6.4.0.02,6.03,10]dodecan-9-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H]2[C@H]3CC[C@H]4[C@@H]2O[C@@]2(C)O[C@](C)(O)[C@@H]3[C@@H]42)cc1 |
| InChI | InChI=1S/C19H24O6S/c1-10-4-6-11(7-5-10)26(21,22)24-17-12-8-9-13-15-14(12)18(2,20)25-19(15,3)23-16(13)17/h4-7,12-17,20H,8-9H2,1-3H3/t12-,13+,14-,15+,16-,17-,18-,19-/m0/s1 |
| InChIKey | CRWHVCBLMIIKTC-DMPCJOICSA-N |
| XLogP | 2.19 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|