C19H22N4O4S2 — CID 6088126
5,5,7,7-tetramethyl-2-[[(E)-3-(5-nitrothiophen-2-yl)prop-2-enoyl]amino]-4,6-dihydrothieno[2,3-c]pyridine-3-carboxamide (PubChem CID 6088126) has the molecular formula C19H22N4O4S2 and a molecular weight of 434.54 g/mol. Its IUPAC name is 5,5,7,7-tetramethyl-2-[[(E)-3-(5-nitrothiophen-2-yl)prop-2-enoyl]amino]-4,6-dihydrothieno[2,3-c]pyridine-3-carboxamide.
| Compound Name | 5,5,7,7-tetramethyl-2-[[(E)-3-(5-nitrothiophen-2-yl)prop-2-enoyl]amino]-4,6-dihydrothieno[2,3-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 6088126 |
| Molecular Formula | C19H22N4O4S2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | 5,5,7,7-tetramethyl-2-[[(E)-3-(5-nitrothiophen-2-yl)prop-2-enoyl]amino]-4,6-dihydrothieno[2,3-c]pyridine-3-carboxamide |
| SMILES | CC1(C)Cc2c(sc(NC(=O)/C=C/c3ccc([N+](=O)[O-])s3)c2C(N)=O)C(C)(C)N1 |
| InChI | InChI=1S/C19H22N4O4S2/c1-18(2)9-11-14(16(20)25)17(29-15(11)19(3,4)22-18)21-12(24)7-5-10-6-8-13(28-10)23(26)27/h5-8,22H,9H2,1-4H3,(H2,20,25)(H,21,24)/b7-5+ |
| InChIKey | RKKLPRBKRARTBU-FNORWQNLSA-N |
| XLogP | 3.63 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|