About 4-azanidylpentan-2-ylazanide;dibromoplatinum(2+)
4-azanidylpentan-2-ylazanide;dibromoplatinum(2+) (PubChem CID 6102231) has the molecular formula C5H12Br2N2Pt
and a molecular weight of 455.05 g/mol. Its IUPAC name is 4-azanidylpentan-2-ylazanide;dibromoplatinum(2+).
Molecular Properties
| Compound Name | 4-azanidylpentan-2-ylazanide;dibromoplatinum(2+) |
| PubChem CID | 6102231 |
| Molecular Formula | C5H12Br2N2Pt |
| Molecular Weight | 455.05 g/mol |
| Exact Mass | 452.90 |
| IUPAC Name | 4-azanidylpentan-2-ylazanide;dibromoplatinum(2+) |
| SMILES | Br[Pt+2]Br.CC([NH-])CC(C)[NH-] |
| InChI | InChI=1S/C5H12N2.2BrH.Pt/c1-4(6)3-5(2)7;;;/h4-7H,3H2,1-2H3;2*1H;/q-2;;;+4/p-2 |
| InChIKey | QJQSCXLSNMOXAF-UHFFFAOYSA-L |
| XLogP | 3.95 |
| TPSA | 47.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 455.05 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4-azanidylpentan-2-ylazanide;dibromoplatinum(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-azanidylpentan-2-ylazanide;dibromoplatinum(2+)?
The IUPAC name of 4-azanidylpentan-2-ylazanide;dibromoplatinum(2+) (CID 6102231) is 4-azanidylpentan-2-ylazanide;dibromoplatinum(2+).
What is the SMILES notation for 4-azanidylpentan-2-ylazanide;dibromoplatinum(2+)?
The canonical SMILES for 4-azanidylpentan-2-ylazanide;dibromoplatinum(2+) is Br[Pt+2]Br.CC([NH-])CC(C)[NH-].
What is the InChIKey of 4-azanidylpentan-2-ylazanide;dibromoplatinum(2+)?
The InChIKey is QJQSCXLSNMOXAF-UHFFFAOYSA-L. The full InChI is InChI=1S/C5H12N2.2BrH.Pt/c1-4(6)3-5(2)7;;;/h4-7H,3H2,1-2H3;2*1H;/q-2;;;+4/p-2.
What are the key properties of 4-azanidylpentan-2-ylazanide;dibromoplatinum(2+)?
4-azanidylpentan-2-ylazanide;dibromoplatinum(2+) has a molecular weight of 455.05 g/mol, XLogP of 3.95, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-azanidylpentan-2-ylazanide;dibromoplatinum(2+) is sourced from PubChem (CID 6102231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).