About platinum;propan-2-ylazanide
platinum;propan-2-ylazanide (PubChem CID 87844212) has the molecular formula C3H8NPt-
and a molecular weight of 253.18 g/mol. Its IUPAC name is platinum;propan-2-ylazanide.
Molecular Properties
| Compound Name | platinum;propan-2-ylazanide |
| PubChem CID | 87844212 |
| Molecular Formula | C3H8NPt- |
| Molecular Weight | 253.18 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | platinum;propan-2-ylazanide |
| SMILES | CC(C)[NH-].[Pt] |
| InChI | InChI=1S/C3H8N.Pt/c1-3(2)4;/h3-4H,1-2H3;/q-1; |
| InChIKey | NAEVERMXXPRSHT-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 23.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.18 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze platinum;propan-2-ylazanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of platinum;propan-2-ylazanide?
The IUPAC name of platinum;propan-2-ylazanide (CID 87844212) is platinum;propan-2-ylazanide.
What is the SMILES notation for platinum;propan-2-ylazanide?
The canonical SMILES for platinum;propan-2-ylazanide is CC(C)[NH-].[Pt].
What is the InChIKey of platinum;propan-2-ylazanide?
The InChIKey is NAEVERMXXPRSHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8N.Pt/c1-3(2)4;/h3-4H,1-2H3;/q-1;.
What are the key properties of platinum;propan-2-ylazanide?
platinum;propan-2-ylazanide has a molecular weight of 253.18 g/mol, XLogP of 1.44, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for platinum;propan-2-ylazanide is sourced from PubChem (CID 87844212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).