About bis(propan-2-ylazanide);tungsten(2+)
bis(propan-2-ylazanide);tungsten(2+) (PubChem CID 58701084) has the molecular formula C6H16N2W
and a molecular weight of 300.05 g/mol. Its IUPAC name is bis(propan-2-ylazanide);tungsten(2+).
Molecular Properties
| Compound Name | bis(propan-2-ylazanide);tungsten(2+) |
| PubChem CID | 58701084 |
| Molecular Formula | C6H16N2W |
| Molecular Weight | 300.05 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | bis(propan-2-ylazanide);tungsten(2+) |
| SMILES | CC(C)[NH-].CC(C)[NH-].[W+2] |
| InChI | InChI=1S/2C3H8N.W/c2*1-3(2)4;/h2*3-4H,1-2H3;/q2*-1;+2 |
| InChIKey | OCJQYWQOZZTETJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 47.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.05 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze bis(propan-2-ylazanide);tungsten(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(propan-2-ylazanide);tungsten(2+)?
The IUPAC name of bis(propan-2-ylazanide);tungsten(2+) (CID 58701084) is bis(propan-2-ylazanide);tungsten(2+).
What is the SMILES notation for bis(propan-2-ylazanide);tungsten(2+)?
The canonical SMILES for bis(propan-2-ylazanide);tungsten(2+) is CC(C)[NH-].CC(C)[NH-].[W+2].
What is the InChIKey of bis(propan-2-ylazanide);tungsten(2+)?
The InChIKey is OCJQYWQOZZTETJ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C3H8N.W/c2*1-3(2)4;/h2*3-4H,1-2H3;/q2*-1;+2.
What are the key properties of bis(propan-2-ylazanide);tungsten(2+)?
bis(propan-2-ylazanide);tungsten(2+) has a molecular weight of 300.05 g/mol, XLogP of 2.89, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(propan-2-ylazanide);tungsten(2+) is sourced from PubChem (CID 58701084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).