C10H16ClN3O4S2 — CID 61046842
2-[(2-chloro-1,3-thiazol-5-yl)sulfonyl-methylamino]-N-(3-methoxypropyl)acetamide (PubChem CID 61046842) has the molecular formula C10H16ClN3O4S2 and a molecular weight of 341.84 g/mol. Its IUPAC name is 2-[(2-chloro-1,3-thiazol-5-yl)sulfonyl-methylamino]-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[(2-chloro-1,3-thiazol-5-yl)sulfonyl-methylamino]-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 61046842 |
| Molecular Formula | C10H16ClN3O4S2 |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | 2-[(2-chloro-1,3-thiazol-5-yl)sulfonyl-methylamino]-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)CN(C)S(=O)(=O)c1cnc(Cl)s1 |
| InChI | InChI=1S/C10H16ClN3O4S2/c1-14(7-8(15)12-4-3-5-18-2)20(16,17)9-6-13-10(11)19-9/h6H,3-5,7H2,1-2H3,(H,12,15) |
| InChIKey | UTECRDXATJLHOI-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|