C7H10ClN3O3S2 — CID 43552871
N-[2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]ethyl]acetamide (PubChem CID 43552871) has the molecular formula C7H10ClN3O3S2 and a molecular weight of 283.76 g/mol. Its IUPAC name is N-[2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]ethyl]acetamide.
| Compound Name | N-[2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 43552871 |
| Molecular Formula | C7H10ClN3O3S2 |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 282.99 |
| IUPAC Name | N-[2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]ethyl]acetamide |
| SMILES | CC(=O)NCCNS(=O)(=O)c1cnc(Cl)s1 |
| InChI | InChI=1S/C7H10ClN3O3S2/c1-5(12)9-2-3-11-16(13,14)6-4-10-7(8)15-6/h4,11H,2-3H2,1H3,(H,9,12) |
| InChIKey | NDKUVURCGLPXDZ-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|