C16H16N4O7 — CID 6110543
N-[2-[(2Z)-2-[(2,4-dimethoxy-5-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]furan-2-carboxamide (PubChem CID 6110543) has the molecular formula C16H16N4O7 and a molecular weight of 376.33 g/mol. Its IUPAC name is N-[2-[(2Z)-2-[(2,4-dimethoxy-5-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]furan-2-carboxamide.
| Compound Name | N-[2-[(2Z)-2-[(2,4-dimethoxy-5-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 6110543 |
| Molecular Formula | C16H16N4O7 |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | N-[2-[(2Z)-2-[(2,4-dimethoxy-5-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]furan-2-carboxamide |
| SMILES | COc1cc(OC)c([N+](=O)[O-])cc1/C=N\NC(=O)CNC(=O)c1ccco1 |
| InChI | InChI=1S/C16H16N4O7/c1-25-13-7-14(26-2)11(20(23)24)6-10(13)8-18-19-15(21)9-17-16(22)12-4-3-5-27-12/h3-8H,9H2,1-2H3,(H,17,22)(H,19,21)/b18-8- |
| InChIKey | WGYNWCTVIXWUEN-LSCVHKIXSA-N |
| XLogP | 1.09 |
| TPSA | 145.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|