C19H10Cl2O2S — CID 611094
(2,4-dichlorophenyl) benzo[g][1]benzothiole-2-carboxylate (PubChem CID 611094) has the molecular formula C19H10Cl2O2S and a molecular weight of 373.26 g/mol. Its IUPAC name is (2,4-dichlorophenyl) benzo[g][1]benzothiole-2-carboxylate.
| Compound Name | (2,4-dichlorophenyl) benzo[g][1]benzothiole-2-carboxylate |
|---|---|
| PubChem CID | 611094 |
| Molecular Formula | C19H10Cl2O2S |
| Molecular Weight | 373.26 g/mol |
| Exact Mass | 371.98 |
| IUPAC Name | (2,4-dichlorophenyl) benzo[g][1]benzothiole-2-carboxylate |
| SMILES | O=C(Oc1ccc(Cl)cc1Cl)c1cc2ccc3ccccc3c2s1 |
| InChI | InChI=1S/C19H10Cl2O2S/c20-13-7-8-16(15(21)10-13)23-19(22)17-9-12-6-5-11-3-1-2-4-14(11)18(12)24-17/h1-10H |
| InChIKey | UBHFIJCJTZOYSO-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.26 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|