C3H8F2N2O4S2 — CID 61131850
2-(difluoromethylsulfonylamino)ethanesulfonamide (PubChem CID 61131850) has the molecular formula C3H8F2N2O4S2 and a molecular weight of 238.24 g/mol. Its IUPAC name is 2-(difluoromethylsulfonylamino)ethanesulfonamide.
| Compound Name | 2-(difluoromethylsulfonylamino)ethanesulfonamide |
|---|---|
| PubChem CID | 61131850 |
| Molecular Formula | C3H8F2N2O4S2 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 237.99 |
| IUPAC Name | 2-(difluoromethylsulfonylamino)ethanesulfonamide |
| SMILES | NS(=O)(=O)CCNS(=O)(=O)C(F)F |
| InChI | InChI=1S/C3H8F2N2O4S2/c4-3(5)13(10,11)7-1-2-12(6,8)9/h3,7H,1-2H2,(H2,6,8,9) |
| InChIKey | UVCZBKGBMLLKON-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |