C9H11Cl2N3 — CID 61361467
N-amino-2,4-dichloro-N'-ethylbenzenecarboximidamide (PubChem CID 61361467) has the molecular formula C9H11Cl2N3 and a molecular weight of 232.11 g/mol. Its IUPAC name is N-amino-2,4-dichloro-N'-ethylbenzenecarboximidamide.
| Compound Name | N-amino-2,4-dichloro-N'-ethylbenzenecarboximidamide |
|---|---|
| PubChem CID | 61361467 |
| Molecular Formula | C9H11Cl2N3 |
| Molecular Weight | 232.11 g/mol |
| Exact Mass | 231.03 |
| IUPAC Name | N-amino-2,4-dichloro-N'-ethylbenzenecarboximidamide |
| SMILES | CC/N=C(\NN)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H11Cl2N3/c1-2-13-9(14-12)7-4-3-6(10)5-8(7)11/h3-5H,2,12H2,1H3,(H,13,14) |
| InChIKey | HTGOBRCOAWCUNA-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.11 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|