C20H21N5 — CID 6161658
N-[(Z)-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]amino]-1H-benzimidazol-2-amine (PubChem CID 6161658) has the molecular formula C20H21N5 and a molecular weight of 331.42 g/mol. Its IUPAC name is N-[(Z)-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]amino]-1H-benzimidazol-2-amine.
| Compound Name | N-[(Z)-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]amino]-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 6161658 |
| Molecular Formula | C20H21N5 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | N-[(Z)-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]amino]-1H-benzimidazol-2-amine |
| SMILES | CN1/C(=C\C=N/Nc2nc3ccccc3[nH]2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C20H21N5/c1-20(2)14-8-4-7-11-17(14)25(3)18(20)12-13-21-24-19-22-15-9-5-6-10-16(15)23-19/h4-13H,1-3H3,(H2,22,23,24)/b18-12-,21-13- |
| InChIKey | ZVJKSSTXCHSUPF-YLNLGVMWSA-N |
| XLogP | 4.27 |
| TPSA | 56.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|