C19H22BrNO — CID 616972
1-[4-(bromomethyl)phenyl]spiro[adamantane-2,4'-azetidine]-2'-one (PubChem CID 616972) has the molecular formula C19H22BrNO and a molecular weight of 360.30 g/mol. Its IUPAC name is 1-[4-(bromomethyl)phenyl]spiro[adamantane-2,4'-azetidine]-2'-one.
| Compound Name | 1-[4-(bromomethyl)phenyl]spiro[adamantane-2,4'-azetidine]-2'-one |
|---|---|
| PubChem CID | 616972 |
| Molecular Formula | C19H22BrNO |
| Molecular Weight | 360.30 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 1-[4-(bromomethyl)phenyl]spiro[adamantane-2,4'-azetidine]-2'-one |
| SMILES | O=C1CC2(N1)C1CC3CC(C1)CC2(c1ccc(CBr)cc1)C3 |
| InChI | InChI=1S/C19H22BrNO/c20-11-12-1-3-15(4-2-12)18-8-13-5-14(9-18)7-16(6-13)19(18)10-17(22)21-19/h1-4,13-14,16H,5-11H2,(H,21,22) |
| InChIKey | PHGMVPRHLKCUHE-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.30 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|