C21H22Cl2F3N3O4S — CID 6173978
(E)-3-[4-[[2-[2,6-dichloro-N-propyl-4-(trifluoromethyl)anilino]ethylamino]sulfamoyl]phenyl]prop-2-enoic acid (PubChem CID 6173978) has the molecular formula C21H22Cl2F3N3O4S and a molecular weight of 540.39 g/mol. Its IUPAC name is (E)-3-[4-[[2-[2,6-dichloro-N-propyl-4-(trifluoromethyl)anilino]ethylamino]sulfamoyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[2-[2,6-dichloro-N-propyl-4-(trifluoromethyl)anilino]ethylamino]sulfamoyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 6173978 |
| Molecular Formula | C21H22Cl2F3N3O4S |
| Molecular Weight | 540.39 g/mol |
| Exact Mass | 539.07 |
| IUPAC Name | (E)-3-[4-[[2-[2,6-dichloro-N-propyl-4-(trifluoromethyl)anilino]ethylamino]sulfamoyl]phenyl]prop-2-enoic acid |
| SMILES | CCCN(CCNNS(=O)(=O)c1ccc(/C=C/C(=O)O)cc1)c1c(Cl)cc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C21H22Cl2F3N3O4S/c1-2-10-29(20-17(22)12-15(13-18(20)23)21(24,25)26)11-9-27-28-34(32,33)16-6-3-14(4-7-16)5-8-19(30)31/h3-8,12-13,27-28H,2,9-11H2,1H3,(H,30,31)/b8-5+ |
| InChIKey | RNCVCYXBYUABNI-VMPITWQZSA-N |
| XLogP | 4.81 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.39 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|