C11H20N2O3 — CID 62012946
ethyl 2-[methyl-[1-oxo-1-(prop-2-enylamino)propan-2-yl]amino]acetate (PubChem CID 62012946) has the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. Its IUPAC name is ethyl 2-[methyl-[1-oxo-1-(prop-2-enylamino)propan-2-yl]amino]acetate.
| Compound Name | ethyl 2-[methyl-[1-oxo-1-(prop-2-enylamino)propan-2-yl]amino]acetate |
|---|---|
| PubChem CID | 62012946 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | ethyl 2-[methyl-[1-oxo-1-(prop-2-enylamino)propan-2-yl]amino]acetate |
| SMILES | C=CCNC(=O)C(C)N(C)CC(=O)OCC |
| InChI | InChI=1S/C11H20N2O3/c1-5-7-12-11(15)9(3)13(4)8-10(14)16-6-2/h5,9H,1,6-8H2,2-4H3,(H,12,15) |
| InChIKey | CQOMOYRWTRCLPC-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|