C28H27N3O5 — CID 6212008
(7-acetamido-2-oxochromen-4-yl)methyl (E)-3-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]prop-2-enoate (PubChem CID 6212008) has the molecular formula C28H27N3O5 and a molecular weight of 485.54 g/mol. Its IUPAC name is (7-acetamido-2-oxochromen-4-yl)methyl (E)-3-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]prop-2-enoate.
| Compound Name | (7-acetamido-2-oxochromen-4-yl)methyl (E)-3-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 6212008 |
| Molecular Formula | C28H27N3O5 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | (7-acetamido-2-oxochromen-4-yl)methyl (E)-3-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]prop-2-enoate |
| SMILES | CC(=O)Nc1ccc2c(COC(=O)/C=C/c3c(C)nn(Cc4ccc(C)cc4)c3C)cc(=O)oc2c1 |
| InChI | InChI=1S/C28H27N3O5/c1-17-5-7-21(8-6-17)15-31-19(3)24(18(2)30-31)11-12-27(33)35-16-22-13-28(34)36-26-14-23(29-20(4)32)9-10-25(22)26/h5-14H,15-16H2,1-4H3,(H,29,32)/b12-11+ |
| InChIKey | CWNNMLQESPOIBH-VAWYXSNFSA-N |
| XLogP | 4.68 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|