C12H19BrN4 — CID 62130610
2-amino-6-(4-bromo-3,5-dimethylpyrazol-1-yl)-2-methylhexanenitrile (PubChem CID 62130610) has the molecular formula C12H19BrN4 and a molecular weight of 299.22 g/mol. Its IUPAC name is 2-amino-6-(4-bromo-3,5-dimethylpyrazol-1-yl)-2-methylhexanenitrile.
| Compound Name | 2-amino-6-(4-bromo-3,5-dimethylpyrazol-1-yl)-2-methylhexanenitrile |
|---|---|
| PubChem CID | 62130610 |
| Molecular Formula | C12H19BrN4 |
| Molecular Weight | 299.22 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 2-amino-6-(4-bromo-3,5-dimethylpyrazol-1-yl)-2-methylhexanenitrile |
| SMILES | Cc1nn(CCCCC(C)(N)C#N)c(C)c1Br |
| InChI | InChI=1S/C12H19BrN4/c1-9-11(13)10(2)17(16-9)7-5-4-6-12(3,15)8-14/h4-7,15H2,1-3H3 |
| InChIKey | ADQQLRRGMHXWMN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 67.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.22 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|