C15H34O5Si3 — CID 621459
bis(trimethylsilyl) 2-methyl-2-trimethylsilyloxypentanedioate (PubChem CID 621459) has the molecular formula C15H34O5Si3 and a molecular weight of 378.69 g/mol. Its IUPAC name is bis(trimethylsilyl) 2-methyl-2-trimethylsilyloxypentanedioate.
| Compound Name | bis(trimethylsilyl) 2-methyl-2-trimethylsilyloxypentanedioate |
|---|---|
| PubChem CID | 621459 |
| Molecular Formula | C15H34O5Si3 |
| Molecular Weight | 378.69 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | bis(trimethylsilyl) 2-methyl-2-trimethylsilyloxypentanedioate |
| SMILES | CC(CCC(=O)O[Si](C)(C)C)(O[Si](C)(C)C)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C15H34O5Si3/c1-15(20-23(8,9)10,14(17)19-22(5,6)7)12-11-13(16)18-21(2,3)4/h11-12H2,1-10H3 |
| InChIKey | PFGMYFCTDHOVAO-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.69 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|