C29H27ClN4O4S — CID 6218991
(E)-N-[1-[2-[2-(2-chlorophenyl)quinoline-4-carbonyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2-phenylethenesulfonamide (PubChem CID 6218991) has the molecular formula C29H27ClN4O4S and a molecular weight of 563.08 g/mol. Its IUPAC name is (E)-N-[1-[2-[2-(2-chlorophenyl)quinoline-4-carbonyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2-phenylethenesulfonamide.
| Compound Name | (E)-N-[1-[2-[2-(2-chlorophenyl)quinoline-4-carbonyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2-phenylethenesulfonamide |
|---|---|
| PubChem CID | 6218991 |
| Molecular Formula | C29H27ClN4O4S |
| Molecular Weight | 563.08 g/mol |
| Exact Mass | 562.14 |
| IUPAC Name | (E)-N-[1-[2-[2-(2-chlorophenyl)quinoline-4-carbonyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2-phenylethenesulfonamide |
| SMILES | CC(C)C(NS(=O)(=O)/C=C/c1ccccc1)C(=O)NNC(=O)c1cc(-c2ccccc2Cl)nc2ccccc12 |
| InChI | InChI=1S/C29H27ClN4O4S/c1-19(2)27(34-39(37,38)17-16-20-10-4-3-5-11-20)29(36)33-32-28(35)23-18-26(22-13-6-8-14-24(22)30)31-25-15-9-7-12-21(23)25/h3-19,27,34H,1-2H3,(H,32,35)(H,33,36)/b17-16+ |
| InChIKey | GBBNBAPMPLVPDY-WUKNDPDISA-N |
| XLogP | 4.93 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.08 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|