C12H13N5OS — CID 62245783
1-[(5-hydrazinylthiadiazol-4-yl)methyl]-3,4-dihydroquinolin-2-one (PubChem CID 62245783) has the molecular formula C12H13N5OS and a molecular weight of 275.34 g/mol. Its IUPAC name is 1-[(5-hydrazinylthiadiazol-4-yl)methyl]-3,4-dihydroquinolin-2-one.
| Compound Name | 1-[(5-hydrazinylthiadiazol-4-yl)methyl]-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 62245783 |
| Molecular Formula | C12H13N5OS |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 1-[(5-hydrazinylthiadiazol-4-yl)methyl]-3,4-dihydroquinolin-2-one |
| SMILES | NNc1snnc1CN1C(=O)CCc2ccccc21 |
| InChI | InChI=1S/C12H13N5OS/c13-14-12-9(15-16-19-12)7-17-10-4-2-1-3-8(10)5-6-11(17)18/h1-4,14H,5-7,13H2 |
| InChIKey | MFDQUTGJEQFBKZ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|