C18H24N2O — CID 62328356
2-methyl-1-(4-propoxyphenyl)-4,5,6,7-tetrahydroindol-4-amine (PubChem CID 62328356) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is 2-methyl-1-(4-propoxyphenyl)-4,5,6,7-tetrahydroindol-4-amine.
| Compound Name | 2-methyl-1-(4-propoxyphenyl)-4,5,6,7-tetrahydroindol-4-amine |
|---|---|
| PubChem CID | 62328356 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 2-methyl-1-(4-propoxyphenyl)-4,5,6,7-tetrahydroindol-4-amine |
| SMILES | CCCOc1ccc(-n2c(C)cc3c2CCCC3N)cc1 |
| InChI | InChI=1S/C18H24N2O/c1-3-11-21-15-9-7-14(8-10-15)20-13(2)12-16-17(19)5-4-6-18(16)20/h7-10,12,17H,3-6,11,19H2,1-2H3 |
| InChIKey | SKJFNWCOJVYBLJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|