C11H10Cl2N2O — CID 6246677
N-[(Z)-[(E)-but-2-enylidene]amino]-3,4-dichlorobenzamide (PubChem CID 6246677) has the molecular formula C11H10Cl2N2O and a molecular weight of 257.12 g/mol. Its IUPAC name is N-[(Z)-[(E)-but-2-enylidene]amino]-3,4-dichlorobenzamide.
| Compound Name | N-[(Z)-[(E)-but-2-enylidene]amino]-3,4-dichlorobenzamide |
|---|---|
| PubChem CID | 6246677 |
| Molecular Formula | C11H10Cl2N2O |
| Molecular Weight | 257.12 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | N-[(Z)-[(E)-but-2-enylidene]amino]-3,4-dichlorobenzamide |
| SMILES | C/C=C/C=N\NC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H10Cl2N2O/c1-2-3-6-14-15-11(16)8-4-5-9(12)10(13)7-8/h2-7H,1H3,(H,15,16)/b3-2+,14-6- |
| InChIKey | NTVUDBHMWRRBFG-VNNOTUCTSA-N |
| XLogP | 3.29 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.12 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|