C10H9Cl2N3O — CID 45276044
N-[(E)-[(E)-but-2-enylidene]amino]-3,6-dichloropyridine-2-carboxamide (PubChem CID 45276044) has the molecular formula C10H9Cl2N3O and a molecular weight of 258.11 g/mol. Its IUPAC name is N-[(E)-[(E)-but-2-enylidene]amino]-3,6-dichloropyridine-2-carboxamide.
| Compound Name | N-[(E)-[(E)-but-2-enylidene]amino]-3,6-dichloropyridine-2-carboxamide |
|---|---|
| PubChem CID | 45276044 |
| Molecular Formula | C10H9Cl2N3O |
| Molecular Weight | 258.11 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | N-[(E)-[(E)-but-2-enylidene]amino]-3,6-dichloropyridine-2-carboxamide |
| SMILES | C/C=C/C=N/NC(=O)c1nc(Cl)ccc1Cl |
| InChI | InChI=1S/C10H9Cl2N3O/c1-2-3-6-13-15-10(16)9-7(11)4-5-8(12)14-9/h2-6H,1H3,(H,15,16)/b3-2+,13-6+ |
| InChIKey | VIGOCRNSYVLJIF-VGOJYEASSA-N |
| XLogP | 2.68 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.11 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|