C7H14N4O — CID 62596699
[3-(3-methylbutyl)-1,2,4-oxadiazol-5-yl]hydrazine (PubChem CID 62596699) has the molecular formula C7H14N4O and a molecular weight of 170.22 g/mol. Its IUPAC name is [3-(3-methylbutyl)-1,2,4-oxadiazol-5-yl]hydrazine.
| Compound Name | [3-(3-methylbutyl)-1,2,4-oxadiazol-5-yl]hydrazine |
|---|---|
| PubChem CID | 62596699 |
| Molecular Formula | C7H14N4O |
| Molecular Weight | 170.22 g/mol |
| Exact Mass | 170.12 |
| IUPAC Name | [3-(3-methylbutyl)-1,2,4-oxadiazol-5-yl]hydrazine |
| SMILES | CC(C)CCc1noc(NN)n1 |
| InChI | InChI=1S/C7H14N4O/c1-5(2)3-4-6-9-7(10-8)12-11-6/h5H,3-4,8H2,1-2H3,(H,9,10,11) |
| InChIKey | DHDNBXVGVREKNB-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.22 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|