C12H20N2O4S — CID 62656194
N-(1,1-dioxothiolan-3-yl)-2-(3-formylpiperidin-1-yl)acetamide (PubChem CID 62656194) has the molecular formula C12H20N2O4S and a molecular weight of 288.37 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-(3-formylpiperidin-1-yl)acetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-(3-formylpiperidin-1-yl)acetamide |
|---|---|
| PubChem CID | 62656194 |
| Molecular Formula | C12H20N2O4S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-(3-formylpiperidin-1-yl)acetamide |
| SMILES | O=CC1CCCN(CC(=O)NC2CCS(=O)(=O)C2)C1 |
| InChI | InChI=1S/C12H20N2O4S/c15-8-10-2-1-4-14(6-10)7-12(16)13-11-3-5-19(17,18)9-11/h8,10-11H,1-7,9H2,(H,13,16) |
| InChIKey | PAQNXBXUXRFTBN-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|