C37H54O6SSi — CID 62705929
[(2R,3R,4R,5R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyl-5,7-bis(phenylmethoxy)heptyl] 4-methylbenzenesulfonate (PubChem CID 62705929) has the molecular formula C37H54O6SSi and a molecular weight of 654.99 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyl-5,7-bis(phenylmethoxy)heptyl] 4-methylbenzenesulfonate.
| Compound Name | [(2R,3R,4R,5R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyl-5,7-bis(phenylmethoxy)heptyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 62705929 |
| Molecular Formula | C37H54O6SSi |
| Molecular Weight | 654.99 g/mol |
| Exact Mass | 654.34 |
| IUPAC Name | [(2R,3R,4R,5R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyl-5,7-bis(phenylmethoxy)heptyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@H](OCc2ccccc2)[C@H](C)COCc2ccccc2)cc1 |
| InChI | InChI=1S/C37H54O6SSi/c1-28-20-22-34(23-21-28)44(38,39)42-25-30(3)36(43-45(8,9)37(5,6)7)31(4)35(41-27-33-18-14-11-15-19-33)29(2)24-40-26-32-16-12-10-13-17-32/h10-23,29-31,35-36H,24-27H2,1-9H3/t29-,30-,31-,35-,36-/m1/s1 |
| InChIKey | DRFDGHAABXWDAL-JRDQXYOKSA-N |
| XLogP | 8.80 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.99 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|